C27H29Cl2N2O6S4+ — CID 175989156
4-[5-chloro-2-[5-[5-chloro-3-(4-sulfobutyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonic acid (PubChem CID 175989156) has the molecular formula C27H29Cl2N2O6S4+ and a molecular weight of 676.71 g/mol. Its IUPAC name is 4-[5-chloro-2-[5-[5-chloro-3-(4-sulfobutyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[5-chloro-2-[5-[5-chloro-3-(4-sulfobutyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 175989156 |
| Molecular Formula | C27H29Cl2N2O6S4+ |
| Molecular Weight | 676.71 g/mol |
| Exact Mass | 675.03 |
| IUPAC Name | 4-[5-chloro-2-[5-[5-chloro-3-(4-sulfobutyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCN1C(=CC=CC=Cc2sc3ccc(Cl)cc3[n+]2CCCCS(=O)(=O)O)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C27H28Cl2N2O6S4/c28-20-10-12-24-22(18-20)30(14-4-6-16-40(32,33)34)26(38-24)8-2-1-3-9-27-31(15-5-7-17-41(35,36)37)23-19-21(29)11-13-25(23)39-27/h1-3,8-13,18-19H,4-7,14-17H2,(H-,32,33,34,35,36,37)/p+1 |
| InChIKey | LRUGERRJMOCDMJ-UHFFFAOYSA-O |
| XLogP | 6.85 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.71 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|