C29H35N2O3S7+ — CID 59958456
4-[2-[(1E,3E,5Z)-5-[3-ethyl-5,6-bis(methylsulfanyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]-5,6-bis(methylsulfanyl)-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid (PubChem CID 59958456) has the molecular formula C29H35N2O3S7+ and a molecular weight of 684.08 g/mol. Its IUPAC name is 4-[2-[(1E,3E,5Z)-5-[3-ethyl-5,6-bis(methylsulfanyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]-5,6-bis(methylsulfanyl)-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[(1E,3E,5Z)-5-[3-ethyl-5,6-bis(methylsulfanyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]-5,6-bis(methylsulfanyl)-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 59958456 |
| Molecular Formula | C29H35N2O3S7+ |
| Molecular Weight | 684.08 g/mol |
| Exact Mass | 683.07 |
| IUPAC Name | 4-[2-[(1E,3E,5Z)-5-[3-ethyl-5,6-bis(methylsulfanyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]-5,6-bis(methylsulfanyl)-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid |
| SMILES | CCN1/C(=C/C=C/C=C/c2sc3cc(SC)c(SC)cc3[n+]2CCCCS(=O)(=O)O)Sc2cc(SC)c(SC)cc21 |
| InChI | InChI=1S/C29H34N2O3S7/c1-6-30-20-16-24(35-2)26(37-4)18-22(20)39-28(30)12-8-7-9-13-29-31(14-10-11-15-41(32,33)34)21-17-25(36-3)27(38-5)19-23(21)40-29/h7-9,12-13,16-19H,6,10-11,14-15H2,1-5H3/p+1 |
| InChIKey | WOGFYNUWLPOPSB-UHFFFAOYSA-O |
| XLogP | 8.79 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.08 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|