C20H20ClN2O3S3+ — CID 22331881
3-[6-chloro-2-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid (PubChem CID 22331881) has the molecular formula C20H20ClN2O3S3+ and a molecular weight of 468.05 g/mol. Its IUPAC name is 3-[6-chloro-2-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[6-chloro-2-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 22331881 |
| Molecular Formula | C20H20ClN2O3S3+ |
| Molecular Weight | 468.05 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 3-[6-chloro-2-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid |
| SMILES | CCN1/C(=C/c2sc3cc(Cl)ccc3[n+]2CCCS(=O)(=O)O)Sc2ccccc21 |
| InChI | InChI=1S/C20H19ClN2O3S3/c1-2-22-15-6-3-4-7-17(15)27-19(22)13-20-23(10-5-11-29(24,25)26)16-9-8-14(21)12-18(16)28-20/h3-4,6-9,12-13H,2,5,10-11H2,1H3/p+1 |
| InChIKey | ZMDPASVQZGTMIS-UHFFFAOYSA-O |
| XLogP | 5.05 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.05 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|