C22H23N2O3S3+ — CID 22310334
3-[2-[(E,3Z)-3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid (PubChem CID 22310334) has the molecular formula C22H23N2O3S3+ and a molecular weight of 459.64 g/mol. Its IUPAC name is 3-[2-[(E,3Z)-3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(E,3Z)-3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 22310334 |
| Molecular Formula | C22H23N2O3S3+ |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 3-[2-[(E,3Z)-3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid |
| SMILES | CCN1/C(=C/C=C/c2sc3ccccc3[n+]2CCCS(=O)(=O)O)Sc2ccccc21 |
| InChI | InChI=1S/C22H22N2O3S3/c1-2-23-17-9-3-5-11-19(17)28-21(23)13-7-14-22-24(15-8-16-30(25,26)27)18-10-4-6-12-20(18)29-22/h3-7,9-14H,2,8,15-16H2,1H3/p+1 |
| InChIKey | BELIVJAZPCXKSL-UHFFFAOYSA-O |
| XLogP | 4.95 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|