C24H27N2O3S3+ — CID 100957873
4-[2-[4-(3-ethyl-1,3-benzothiazol-2-ylidene)but-2-en-2-yl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid (PubChem CID 100957873) has the molecular formula C24H27N2O3S3+ and a molecular weight of 487.69 g/mol. Its IUPAC name is 4-[2-[4-(3-ethyl-1,3-benzothiazol-2-ylidene)but-2-en-2-yl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[4-(3-ethyl-1,3-benzothiazol-2-ylidene)but-2-en-2-yl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 100957873 |
| Molecular Formula | C24H27N2O3S3+ |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 4-[2-[4-(3-ethyl-1,3-benzothiazol-2-ylidene)but-2-en-2-yl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid |
| SMILES | CCN1C(=CC=C(C)c2sc3ccccc3[n+]2CCCCS(=O)(=O)O)Sc2ccccc21 |
| InChI | InChI=1S/C24H26N2O3S3/c1-3-25-19-10-4-6-12-21(19)30-23(25)15-14-18(2)24-26(16-8-9-17-32(27,28)29)20-11-5-7-13-22(20)31-24/h4-7,10-15H,3,8-9,16-17H2,1-2H3/p+1 |
| InChIKey | NBVVFTHCAKIJIL-UHFFFAOYSA-O |
| XLogP | 5.73 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|