C25H30N3S2+ — CID 57017652
5-[2-[3-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-methylprop-1-enyl]-1,3-benzothiazol-3-ium-3-yl]pentan-1-amine (PubChem CID 57017652) has the molecular formula C25H30N3S2+ and a molecular weight of 436.67 g/mol. Its IUPAC name is 5-[2-[3-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-methylprop-1-enyl]-1,3-benzothiazol-3-ium-3-yl]pentan-1-amine.
| Compound Name | 5-[2-[3-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-methylprop-1-enyl]-1,3-benzothiazol-3-ium-3-yl]pentan-1-amine |
|---|---|
| PubChem CID | 57017652 |
| Molecular Formula | C25H30N3S2+ |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 5-[2-[3-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-methylprop-1-enyl]-1,3-benzothiazol-3-ium-3-yl]pentan-1-amine |
| SMILES | CCN1C(=CC(C)=Cc2sc3ccccc3[n+]2CCCCCN)Sc2ccccc21 |
| InChI | InChI=1S/C25H30N3S2/c1-3-27-20-11-5-7-13-22(20)29-24(27)17-19(2)18-25-28(16-10-4-9-15-26)21-12-6-8-14-23(21)30-25/h5-8,11-14,17-18H,3-4,9-10,15-16,26H2,1-2H3/q+1 |
| InChIKey | RNSGXMDROFDPOJ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 33.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|