C22H23N3O3S3 — CID 3720807
3-[2-[2-amino-3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 3720807) has the molecular formula C22H23N3O3S3 and a molecular weight of 473.65 g/mol. Its IUPAC name is 3-[2-[2-amino-3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[2-amino-3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 3720807 |
| Molecular Formula | C22H23N3O3S3 |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 3-[2-[2-amino-3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | CCN1C(=CC(N)=Cc2sc3ccccc3[n+]2CCCS(=O)(=O)[O-])Sc2ccccc21 |
| InChI | InChI=1S/C22H23N3O3S3/c1-2-24-17-8-3-5-10-19(17)29-21(24)14-16(23)15-22-25(12-7-13-31(26,27)28)18-9-4-6-11-20(18)30-22/h3-6,8-11,14-15,23H,2,7,12-13H2,1H3,(H,26,27,28) |
| InChIKey | UOPGUEGTEGFAKJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|