C24H26N2O3S2Se — CID 4183764
3-[2-[2-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-1,3-benzoselenazol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 4183764) has the molecular formula C24H26N2O3S2Se and a molecular weight of 533.58 g/mol. Its IUPAC name is 3-[2-[2-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-1,3-benzoselenazol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[2-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-1,3-benzoselenazol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 4183764 |
| Molecular Formula | C24H26N2O3S2Se |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | 3-[2-[2-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-1,3-benzoselenazol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | CCC(=Cc1[se]c2ccccc2[n+]1CCCS(=O)(=O)[O-])C=C1Sc2ccccc2N1CC |
| InChI | InChI=1S/C24H26N2O3S2Se/c1-3-18(16-23-25(4-2)19-10-5-7-12-21(19)30-23)17-24-26(14-9-15-31(27,28)29)20-11-6-8-13-22(20)32-24/h5-8,10-13,16-17H,3-4,9,14-15H2,1-2H3 |
| InChIKey | HDLHQQFONUMMFG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|