C23H25N2O3S3+ — CID 54249752
2-[2-[2-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]ethanesulfonic acid (PubChem CID 54249752) has the molecular formula C23H25N2O3S3+ and a molecular weight of 473.67 g/mol. Its IUPAC name is 2-[2-[2-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]ethanesulfonic acid.
| Compound Name | 2-[2-[2-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 54249752 |
| Molecular Formula | C23H25N2O3S3+ |
| Molecular Weight | 473.67 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 2-[2-[2-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]ethanesulfonic acid |
| SMILES | CCC(=Cc1sc2ccccc2[n+]1CCS(=O)(=O)O)C=C1Sc2ccccc2N1CC |
| InChI | InChI=1S/C23H24N2O3S3/c1-3-17(15-22-24(4-2)18-9-5-7-11-20(18)29-22)16-23-25(13-14-31(26,27)28)19-10-6-8-12-21(19)30-23/h5-12,15-16H,3-4,13-14H2,1-2H3/p+1 |
| InChIKey | QVXLFNNCQAVCTC-UHFFFAOYSA-O |
| XLogP | 5.34 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.67 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|