C23H21N2O4S2+ — CID 101069653
2-[2-[2-[[3-(carboxymethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]acetic acid (PubChem CID 101069653) has the molecular formula C23H21N2O4S2+ and a molecular weight of 453.57 g/mol. Its IUPAC name is 2-[2-[2-[[3-(carboxymethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]acetic acid.
| Compound Name | 2-[2-[2-[[3-(carboxymethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 101069653 |
| Molecular Formula | C23H21N2O4S2+ |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 2-[2-[2-[[3-(carboxymethyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]acetic acid |
| SMILES | CCC(=Cc1sc2ccccc2[n+]1CC(=O)O)C=C1Sc2ccccc2N1CC(=O)O |
| InChI | InChI=1S/C23H20N2O4S2/c1-2-15(11-20-24(13-22(26)27)16-7-3-5-9-18(16)30-20)12-21-25(14-23(28)29)17-8-4-6-10-19(17)31-21/h3-12H,2,13-14H2,1H3,(H-,26,27,28,29)/p+1 |
| InChIKey | FTDGWZANXAZTAI-UHFFFAOYSA-O |
| XLogP | 4.61 |
| TPSA | 81.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|