C26H22N2O3S2 — CID 54375597
3-[2-[(1E,3E,5E,7E)-7-[3-(carboxymethyl)-1,3-benzothiazol-2-ylidene]hepta-1,3,5-trienyl]-1,3-benzothiazol-3-ium-3-yl]prop-1-en-2-olate (PubChem CID 54375597) has the molecular formula C26H22N2O3S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 3-[2-[(1E,3E,5E,7E)-7-[3-(carboxymethyl)-1,3-benzothiazol-2-ylidene]hepta-1,3,5-trienyl]-1,3-benzothiazol-3-ium-3-yl]prop-1-en-2-olate.
| Compound Name | 3-[2-[(1E,3E,5E,7E)-7-[3-(carboxymethyl)-1,3-benzothiazol-2-ylidene]hepta-1,3,5-trienyl]-1,3-benzothiazol-3-ium-3-yl]prop-1-en-2-olate |
|---|---|
| PubChem CID | 54375597 |
| Molecular Formula | C26H22N2O3S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 3-[2-[(1E,3E,5E,7E)-7-[3-(carboxymethyl)-1,3-benzothiazol-2-ylidene]hepta-1,3,5-trienyl]-1,3-benzothiazol-3-ium-3-yl]prop-1-en-2-olate |
| SMILES | C=C([O-])C[n+]1c(/C=C/C=C/C=C/C=C2/Sc3ccccc3N2CC(=O)O)sc2ccccc21 |
| InChI | InChI=1S/C26H22N2O3S2/c1-19(29)17-27-20-11-7-9-13-22(20)32-24(27)15-5-3-2-4-6-16-25-28(18-26(30)31)21-12-8-10-14-23(21)33-25/h2-16H,1,17-18H2,(H-,29,30,31) |
| InChIKey | UWGUJWJAPIXQEE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|