C28H29N2O2S2+ — CID 20737271
6-[(2Z)-2-[(2E,4E,6E)-7-(3-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]hexanoic acid (PubChem CID 20737271) has the molecular formula C28H29N2O2S2+ and a molecular weight of 489.69 g/mol. Its IUPAC name is 6-[(2Z)-2-[(2E,4E,6E)-7-(3-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]hexanoic acid.
| Compound Name | 6-[(2Z)-2-[(2E,4E,6E)-7-(3-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 20737271 |
| Molecular Formula | C28H29N2O2S2+ |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 6-[(2Z)-2-[(2E,4E,6E)-7-(3-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]hexanoic acid |
| SMILES | C[n+]1c(/C=C/C=C/C=C/C=C2\Sc3ccccc3N2CCCCCC(=O)O)sc2ccccc21 |
| InChI | InChI=1S/C28H28N2O2S2/c1-29-22-14-9-11-16-24(22)33-26(29)18-6-3-2-4-7-19-27-30(21-13-5-8-20-28(31)32)23-15-10-12-17-25(23)34-27/h2-4,6-7,9-12,14-19H,5,8,13,20-21H2,1H3/p+1 |
| InChIKey | FYSMWHJJXMSWNJ-UHFFFAOYSA-O |
| XLogP | 6.95 |
| TPSA | 44.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|