C33H37N2O4S2+ — CID 23640126
6-[2-[7-[3-(5-carboxypentyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]hexanoic acid (PubChem CID 23640126) has the molecular formula C33H37N2O4S2+ and a molecular weight of 589.80 g/mol. Its IUPAC name is 6-[2-[7-[3-(5-carboxypentyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]hexanoic acid.
| Compound Name | 6-[2-[7-[3-(5-carboxypentyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 23640126 |
| Molecular Formula | C33H37N2O4S2+ |
| Molecular Weight | 589.80 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | 6-[2-[7-[3-(5-carboxypentyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=CC=CC=CC=Cc2sc3ccccc3[n+]2CCCCCC(=O)O)Sc2ccccc21 |
| InChI | InChI=1S/C33H36N2O4S2/c36-32(37)22-8-4-14-24-34-26-16-10-12-18-28(26)40-30(34)20-6-2-1-3-7-21-31-35(25-15-5-9-23-33(38)39)27-17-11-13-19-29(27)41-31/h1-3,6-7,10-13,16-21H,4-5,8-9,14-15,22-25H2,(H-,36,37,38,39)/p+1 |
| InChIKey | DEPVOESAHGFMHM-UHFFFAOYSA-O |
| XLogP | 8.06 |
| TPSA | 81.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.80 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|