C21H21N2O2S2+ — CID 20594923
2-[(2E)-2-[(E)-3-[3-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]ethanol (PubChem CID 20594923) has the molecular formula C21H21N2O2S2+ and a molecular weight of 397.55 g/mol. Its IUPAC name is 2-[(2E)-2-[(E)-3-[3-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]ethanol.
| Compound Name | 2-[(2E)-2-[(E)-3-[3-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 20594923 |
| Molecular Formula | C21H21N2O2S2+ |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-[(2E)-2-[(E)-3-[3-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]ethanol |
| SMILES | OCCN1/C(=C\C=C\c2sc3ccccc3[n+]2CCO)Sc2ccccc21 |
| InChI | InChI=1S/C21H21N2O2S2/c24-14-12-22-16-6-1-3-8-18(16)26-20(22)10-5-11-21-23(13-15-25)17-7-2-4-9-19(17)27-21/h1-11,24-25H,12-15H2/q+1 |
| InChIKey | DIDPLZYTLXCHNW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|