C27H29N2O2S4+ — CID 6519478
S-[3-[(2Z)-2-[(E)-3-[3-(3-acetylsulfanylpropyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]propyl] ethanethioate (PubChem CID 6519478) has the molecular formula C27H29N2O2S4+ and a molecular weight of 541.81 g/mol. Its IUPAC name is S-[3-[(2Z)-2-[(E)-3-[3-(3-acetylsulfanylpropyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]propyl] ethanethioate.
| Compound Name | S-[3-[(2Z)-2-[(E)-3-[3-(3-acetylsulfanylpropyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]propyl] ethanethioate |
|---|---|
| PubChem CID | 6519478 |
| Molecular Formula | C27H29N2O2S4+ |
| Molecular Weight | 541.81 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | S-[3-[(2Z)-2-[(E)-3-[3-(3-acetylsulfanylpropyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]propyl] ethanethioate |
| SMILES | CC(=O)SCCCN1/C(=C/C=C/c2sc3ccccc3[n+]2CCCSC(C)=O)Sc2ccccc21 |
| InChI | InChI=1S/C27H29N2O2S4/c1-20(30)32-18-8-16-28-22-10-3-5-12-24(22)34-26(28)14-7-15-27-29(17-9-19-33-21(2)31)23-11-4-6-13-25(23)35-27/h3-7,10-15H,8-9,16-19H2,1-2H3/q+1 |
| InChIKey | OMVJWPWJQQHYGT-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 41.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.81 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|