C53H85N4S2+3 — CID 58675647
triethyl-[10-[2-[7-[3-[10-(triethylazaniumyl)decyl]-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]decyl]azanium (PubChem CID 58675647) has the molecular formula C53H85N4S2+3 and a molecular weight of 842.43 g/mol. Its IUPAC name is triethyl-[10-[2-[7-[3-[10-(triethylazaniumyl)decyl]-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]decyl]azanium.
| Compound Name | triethyl-[10-[2-[7-[3-[10-(triethylazaniumyl)decyl]-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]decyl]azanium |
|---|---|
| PubChem CID | 58675647 |
| Molecular Formula | C53H85N4S2+3 |
| Molecular Weight | 842.43 g/mol |
| Exact Mass | 841.62 |
| IUPAC Name | triethyl-[10-[2-[7-[3-[10-(triethylazaniumyl)decyl]-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]decyl]azanium |
| SMILES | CC[N+](CC)(CC)CCCCCCCCCCN1C(=CC=CC=CC=Cc2sc3ccccc3[n+]2CCCCCCCCCC[N+](CC)(CC)CC)Sc2ccccc21 |
| InChI | InChI=1S/C53H85N4S2/c1-7-56(8-2,9-3)46-36-26-19-15-13-17-24-34-44-54-48-38-30-32-40-50(48)58-52(54)42-28-22-21-23-29-43-53-55(49-39-31-33-41-51(49)59-53)45-35-25-18-14-16-20-27-37-47-57(10-4,11-5)12-6/h21-23,28-33,38-43H,7-20,24-27,34-37,44-47H2,1-6H3/q+3 |
| InChIKey | OTAWIPYRUSCJPT-UHFFFAOYSA-N |
| XLogP | 14.76 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.43 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|