C32H41N3S2+2 — CID 58675755
triethyl-[3-[2-[7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-1,3-benzothiazol-3-ium-3-yl]propyl]azanium (PubChem CID 58675755) has the molecular formula C32H41N3S2+2 and a molecular weight of 531.84 g/mol. Its IUPAC name is triethyl-[3-[2-[7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-1,3-benzothiazol-3-ium-3-yl]propyl]azanium.
| Compound Name | triethyl-[3-[2-[7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-1,3-benzothiazol-3-ium-3-yl]propyl]azanium |
|---|---|
| PubChem CID | 58675755 |
| Molecular Formula | C32H41N3S2+2 |
| Molecular Weight | 531.84 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | triethyl-[3-[2-[7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-1,3-benzothiazol-3-ium-3-yl]propyl]azanium |
| SMILES | CCN1C(=CC=CC=CC=Cc2sc3ccccc3[n+]2CCC[N+](CC)(CC)CC)Sc2ccccc21 |
| InChI | InChI=1S/C32H41N3S2/c1-5-33-27-19-14-16-21-29(27)36-31(33)23-12-10-9-11-13-24-32-34(28-20-15-17-22-30(28)37-32)25-18-26-35(6-2,7-3)8-4/h9-17,19-24H,5-8,18,25-26H2,1-4H3/q+2 |
| InChIKey | AIWPUOZMMRDKTL-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.84 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|