C36H33N2S2+ — CID 89165949
2-[(1E,3E,5E,7Z)-7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-3-(3-naphthalen-2-ylpropyl)-1,3-benzothiazol-3-ium (PubChem CID 89165949) has the molecular formula C36H33N2S2+ and a molecular weight of 557.81 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7Z)-7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-3-(3-naphthalen-2-ylpropyl)-1,3-benzothiazol-3-ium.
| Compound Name | 2-[(1E,3E,5E,7Z)-7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-3-(3-naphthalen-2-ylpropyl)-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 89165949 |
| Molecular Formula | C36H33N2S2+ |
| Molecular Weight | 557.81 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 2-[(1E,3E,5E,7Z)-7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-3-(3-naphthalen-2-ylpropyl)-1,3-benzothiazol-3-ium |
| SMILES | CCN1/C(=C/C=C/C=C/C=C/c2sc3ccccc3[n+]2CCCc2ccc3ccccc3c2)Sc2ccccc21 |
| InChI | InChI=1S/C36H33N2S2/c1-2-37-31-18-10-12-20-33(31)39-35(37)22-6-4-3-5-7-23-36-38(32-19-11-13-21-34(32)40-36)26-14-15-28-24-25-29-16-8-9-17-30(29)27-28/h3-13,16-25,27H,2,14-15,26H2,1H3/q+1 |
| InChIKey | AZQRUAMAPXSXLN-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.81 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|