C37H44N2O4S2 — CID 23637632
8-[2-[(1E,3E,5E,7Z)-7-[3-(7-carboxyheptyl)-1,3-benzothiazol-2-ylidene]hepta-1,3,5-trienyl]-1,3-benzothiazol-3-ium-3-yl]octanoate (PubChem CID 23637632) has the molecular formula C37H44N2O4S2 and a molecular weight of 644.90 g/mol. Its IUPAC name is 8-[2-[(1E,3E,5E,7Z)-7-[3-(7-carboxyheptyl)-1,3-benzothiazol-2-ylidene]hepta-1,3,5-trienyl]-1,3-benzothiazol-3-ium-3-yl]octanoate.
| Compound Name | 8-[2-[(1E,3E,5E,7Z)-7-[3-(7-carboxyheptyl)-1,3-benzothiazol-2-ylidene]hepta-1,3,5-trienyl]-1,3-benzothiazol-3-ium-3-yl]octanoate |
|---|---|
| PubChem CID | 23637632 |
| Molecular Formula | C37H44N2O4S2 |
| Molecular Weight | 644.90 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | 8-[2-[(1E,3E,5E,7Z)-7-[3-(7-carboxyheptyl)-1,3-benzothiazol-2-ylidene]hepta-1,3,5-trienyl]-1,3-benzothiazol-3-ium-3-yl]octanoate |
| SMILES | O=C([O-])CCCCCCC[n+]1c(/C=C/C=C/C=C/C=C2\Sc3ccccc3N2CCCCCCCC(=O)O)sc2ccccc21 |
| InChI | InChI=1S/C37H44N2O4S2/c40-36(41)26-12-6-2-8-18-28-38-30-20-14-16-22-32(30)44-34(38)24-10-4-1-5-11-25-35-39(31-21-15-17-23-33(31)45-35)29-19-9-3-7-13-27-37(42)43/h1,4-5,10-11,14-17,20-25H,2-3,6-9,12-13,18-19,26-29H2,(H-,40,41,42,43) |
| InChIKey | YNIDUMWBJKMKNR-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.90 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|