C25H23N2O4S2+ — CID 76760398
3-[2-[5-[3-(2-formyloxyethyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid (PubChem CID 76760398) has the molecular formula C25H23N2O4S2+ and a molecular weight of 479.60 g/mol. Its IUPAC name is 3-[2-[5-[3-(2-formyloxyethyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid.
| Compound Name | 3-[2-[5-[3-(2-formyloxyethyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid |
|---|---|
| PubChem CID | 76760398 |
| Molecular Formula | C25H23N2O4S2+ |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 3-[2-[5-[3-(2-formyloxyethyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]-1,3-benzothiazol-3-ium-3-yl]propanoic acid |
| SMILES | O=COCCN1C(=CC=CC=Cc2sc3ccccc3[n+]2CCC(=O)O)Sc2ccccc21 |
| InChI | InChI=1S/C25H22N2O4S2/c28-18-31-17-16-27-20-9-5-7-11-22(20)33-24(27)13-3-1-2-12-23-26(15-14-25(29)30)19-8-4-6-10-21(19)32-23/h1-13,18H,14-17H2/p+1 |
| InChIKey | AGCHPKQSLWEAHW-UHFFFAOYSA-O |
| XLogP | 4.86 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|