C30H31N2O4S2+ — CID 23526006
ethyl 3-[(2E)-2-[(2E,4E,6E)-7-[3-(2-ethoxy-2-oxoethyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]propanoate (PubChem CID 23526006) has the molecular formula C30H31N2O4S2+ and a molecular weight of 547.72 g/mol. Its IUPAC name is ethyl 3-[(2E)-2-[(2E,4E,6E)-7-[3-(2-ethoxy-2-oxoethyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]propanoate.
| Compound Name | ethyl 3-[(2E)-2-[(2E,4E,6E)-7-[3-(2-ethoxy-2-oxoethyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]propanoate |
|---|---|
| PubChem CID | 23526006 |
| Molecular Formula | C30H31N2O4S2+ |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | ethyl 3-[(2E)-2-[(2E,4E,6E)-7-[3-(2-ethoxy-2-oxoethyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzothiazol-3-yl]propanoate |
| SMILES | CCOC(=O)CCN1/C(=C\C=C\C=C\C=C\c2sc3ccccc3[n+]2CC(=O)OCC)Sc2ccccc21 |
| InChI | InChI=1S/C30H31N2O4S2/c1-3-35-29(33)20-21-31-23-14-10-12-16-25(23)37-27(31)18-8-6-5-7-9-19-28-32(22-30(34)36-4-2)24-15-11-13-17-26(24)38-28/h5-19H,3-4,20-22H2,1-2H3/q+1 |
| InChIKey | BRSLTIFLVYLJQK-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|