C25H23BrN2O4S2 — CID 91869543
3-[2-[5-[3-(2-carboxyethyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propanoic acid bromide (PubChem CID 91869543) has the molecular formula C25H23BrN2O4S2 and a molecular weight of 559.51 g/mol. Its IUPAC name is 3-[2-[5-[3-(2-carboxyethyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propanoic acid bromide.
| Compound Name | 3-[2-[5-[3-(2-carboxyethyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propanoic acid bromide |
|---|---|
| PubChem CID | 91869543 |
| Molecular Formula | C25H23BrN2O4S2 |
| Molecular Weight | 559.51 g/mol |
| Exact Mass | 558.03 |
| IUPAC Name | 3-[2-[5-[3-(2-carboxyethyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propanoic acid bromide |
| SMILES | O=C(O)CCN1C(=CC=CC=Cc2sc3ccccc3[n+]2CCC(=O)O)Sc2ccccc21.[Br-] |
| InChI | InChI=1S/C25H22N2O4S2.BrH/c28-24(29)14-16-26-18-8-4-6-10-20(18)32-22(26)12-2-1-3-13-23-27(17-15-25(30)31)19-9-5-7-11-21(19)33-23;/h1-13H,14-17H2,(H-,28,29,30,31);1H |
| InChIKey | FWQBVGXQBKLKPV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 81.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|