C25H22N3O3S2+ — CID 58321832
3-[(2Z)-2-[(2Z,4E)-3-cyano-5-[3-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propanoic acid (PubChem CID 58321832) has the molecular formula C25H22N3O3S2+ and a molecular weight of 476.60 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2Z,4E)-3-cyano-5-[3-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propanoic acid.
| Compound Name | 3-[(2Z)-2-[(2Z,4E)-3-cyano-5-[3-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 58321832 |
| Molecular Formula | C25H22N3O3S2+ |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 3-[(2Z)-2-[(2Z,4E)-3-cyano-5-[3-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propanoic acid |
| SMILES | N#CC(=C\C=C1/Sc2ccccc2N1CCC(=O)O)/C=C/c1sc2ccccc2[n+]1CCO |
| InChI | InChI=1S/C25H21N3O3S2/c26-17-18(10-12-24-28(15-16-29)20-6-2-4-8-22(20)33-24)9-11-23-27(14-13-25(30)31)19-5-1-3-7-21(19)32-23/h1-12,29H,13-16H2/p+1 |
| InChIKey | MCAMJXHESIKSCZ-UHFFFAOYSA-O |
| XLogP | 4.57 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|