C31H42BrN4S2+3 — CID 71483685
3-[(2Z)-2-[(2Z,4E)-3-bromo-5-[3-[3-(trimethylazaniumyl)propyl]-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propyl-trimethylazanium (PubChem CID 71483685) has the molecular formula C31H42BrN4S2+3 and a molecular weight of 614.74 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2Z,4E)-3-bromo-5-[3-[3-(trimethylazaniumyl)propyl]-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propyl-trimethylazanium.
| Compound Name | 3-[(2Z)-2-[(2Z,4E)-3-bromo-5-[3-[3-(trimethylazaniumyl)propyl]-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 71483685 |
| Molecular Formula | C31H42BrN4S2+3 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 613.20 |
| IUPAC Name | 3-[(2Z)-2-[(2Z,4E)-3-bromo-5-[3-[3-(trimethylazaniumyl)propyl]-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCN1/C(=C/C=C(Br)/C=C/c2sc3ccccc3[n+]2CCC[N+](C)(C)C)Sc2ccccc21 |
| InChI | InChI=1S/C31H42BrN4S2/c1-35(2,3)23-11-21-33-26-13-7-9-15-28(26)37-30(33)19-17-25(32)18-20-31-34(22-12-24-36(4,5)6)27-14-8-10-16-29(27)38-31/h7-10,13-20H,11-12,21-24H2,1-6H3/q+3 |
| InChIKey | JNTGTBGHKKQRFF-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|