C32H31IN3S3+ — CID 51346655
(2Z)-2-[(2E,4E)-3,5-bis(3-ethyl-1,3-benzothiazol-3-ium-2-yl)penta-2,4-dienylidene]-3-ethyl-1,3-benzothiazole iodide (PubChem CID 51346655) has the molecular formula C32H31IN3S3+ and a molecular weight of 680.73 g/mol. Its IUPAC name is (2Z)-2-[(2E,4E)-3,5-bis(3-ethyl-1,3-benzothiazol-3-ium-2-yl)penta-2,4-dienylidene]-3-ethyl-1,3-benzothiazole iodide.
| Compound Name | (2Z)-2-[(2E,4E)-3,5-bis(3-ethyl-1,3-benzothiazol-3-ium-2-yl)penta-2,4-dienylidene]-3-ethyl-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 51346655 |
| Molecular Formula | C32H31IN3S3+ |
| Molecular Weight | 680.73 g/mol |
| Exact Mass | 680.07 |
| IUPAC Name | (2Z)-2-[(2E,4E)-3,5-bis(3-ethyl-1,3-benzothiazol-3-ium-2-yl)penta-2,4-dienylidene]-3-ethyl-1,3-benzothiazole iodide |
| SMILES | CCN1/C(=C/C=C(\C=C\c2sc3ccccc3[n+]2CC)c2sc3ccccc3[n+]2CC)Sc2ccccc21.[I-] |
| InChI | InChI=1S/C32H31N3S3.HI/c1-4-33-24-13-7-10-16-27(24)36-30(33)21-19-23(32-35(6-3)26-15-9-12-18-29(26)38-32)20-22-31-34(5-2)25-14-8-11-17-28(25)37-31;/h7-22H,4-6H2,1-3H3;1H/q+2;/p-1 |
| InChIKey | QTTAHLUGNZGGIW-UHFFFAOYSA-M |
| XLogP | 5.31 |
| TPSA | 11.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.73 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|