C31H32N2O3S3 — CID 45026250
(2E)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-3-methylpenta-2,4-dienylidene]-1,3-benzothiazole;4-methylbenzenesulfonate (PubChem CID 45026250) has the molecular formula C31H32N2O3S3 and a molecular weight of 576.81 g/mol. Its IUPAC name is (2E)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-3-methylpenta-2,4-dienylidene]-1,3-benzothiazole;4-methylbenzenesulfonate.
| Compound Name | (2E)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-3-methylpenta-2,4-dienylidene]-1,3-benzothiazole;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 45026250 |
| Molecular Formula | C31H32N2O3S3 |
| Molecular Weight | 576.81 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | (2E)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-3-methylpenta-2,4-dienylidene]-1,3-benzothiazole;4-methylbenzenesulfonate |
| SMILES | CCN1/C(=C\C=C(C)\C=C\c2sc3ccccc3[n+]2CC)Sc2ccccc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C24H25N2S2.C7H8O3S/c1-4-25-19-10-6-8-12-21(19)27-23(25)16-14-18(3)15-17-24-26(5-2)20-11-7-9-13-22(20)28-24;1-6-2-4-7(5-3-6)11(8,9)10/h6-17H,4-5H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | SHGOOMURRLZBIK-UHFFFAOYSA-M |
| XLogP | 7.54 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.81 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|