C21H24N2O4S3 — CID 75627980
3-ethyl-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazole;ethyl sulfate (PubChem CID 75627980) has the molecular formula C21H24N2O4S3 and a molecular weight of 464.63 g/mol. Its IUPAC name is 3-ethyl-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazole;ethyl sulfate.
| Compound Name | 3-ethyl-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazole;ethyl sulfate |
|---|---|
| PubChem CID | 75627980 |
| Molecular Formula | C21H24N2O4S3 |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 3-ethyl-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazole;ethyl sulfate |
| SMILES | CCN1C(=Cc2sc3ccccc3[n+]2CC)Sc2ccccc21.CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C19H19N2S2.C2H6O4S/c1-3-20-14-9-5-7-11-16(14)22-18(20)13-19-21(4-2)15-10-6-8-12-17(15)23-19;1-2-6-7(3,4)5/h5-13H,3-4H2,1-2H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | NLGSCOPBXPXNRT-UHFFFAOYSA-M |
| XLogP | 4.62 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|