C25H20N2O3S2 — CID 15962476
(5Z)-5-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-3,4-dioxocyclopenten-1-olate (PubChem CID 15962476) has the molecular formula C25H20N2O3S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is (5Z)-5-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-3,4-dioxocyclopenten-1-olate.
| Compound Name | (5Z)-5-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-3,4-dioxocyclopenten-1-olate |
|---|---|
| PubChem CID | 15962476 |
| Molecular Formula | C25H20N2O3S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | (5Z)-5-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-3,4-dioxocyclopenten-1-olate |
| SMILES | CCN1/C(=C/C2=C([O-])/C(=C/c3sc4ccccc4[n+]3CC)C(=O)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C25H20N2O3S2/c1-3-26-17-9-5-7-11-19(17)31-21(26)13-15-23(28)16(25(30)24(15)29)14-22-27(4-2)18-10-6-8-12-20(18)32-22/h5-14H,3-4H2,1-2H3 |
| InChIKey | FMHOQQJZROLMAX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|