C24H20N2O2S2 — CID 11235829
(4Z)-4-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(E)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-3-oxocyclobuten-1-olate (PubChem CID 11235829) has the molecular formula C24H20N2O2S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is (4Z)-4-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(E)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-3-oxocyclobuten-1-olate.
| Compound Name | (4Z)-4-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(E)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 11235829 |
| Molecular Formula | C24H20N2O2S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | (4Z)-4-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-2-[(E)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-3-oxocyclobuten-1-olate |
| SMILES | CCN1/C(=C\C2=C([O-])/C(=C/c3sc4ccccc4[n+]3CC)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C24H20N2O2S2/c1-3-25-17-9-5-7-11-19(17)29-21(25)13-15-23(27)16(24(15)28)14-22-26(4-2)18-10-6-8-12-20(18)30-22/h5-14H,3-4H2,1-2H3 |
| InChIKey | QGPLEIXNDHGZCL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|