C27H25N2S2+ — CID 2332446
3-ethyl-2-[(E,3E)-3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-6-phenyl-1,3-benzothiazol-3-ium (PubChem CID 2332446) has the molecular formula C27H25N2S2+ and a molecular weight of 441.65 g/mol. Its IUPAC name is 3-ethyl-2-[(E,3E)-3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-6-phenyl-1,3-benzothiazol-3-ium.
| Compound Name | 3-ethyl-2-[(E,3E)-3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-6-phenyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 2332446 |
| Molecular Formula | C27H25N2S2+ |
| Molecular Weight | 441.65 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 3-ethyl-2-[(E,3E)-3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-6-phenyl-1,3-benzothiazol-3-ium |
| SMILES | CCN1/C(=C\C=C\c2sc3cc(-c4ccccc4)ccc3[n+]2CC)Sc2ccccc21 |
| InChI | InChI=1S/C27H25N2S2/c1-3-28-22-13-8-9-14-24(22)30-26(28)15-10-16-27-29(4-2)23-18-17-21(19-25(23)31-27)20-11-6-5-7-12-20/h5-19H,3-4H2,1-2H3/q+1 |
| InChIKey | VPJIBFUJXWTIQZ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.65 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|