C21H23IN4S2 — CID 75611665
2-[3-(6-amino-3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-amine iodide (PubChem CID 75611665) has the molecular formula C21H23IN4S2 and a molecular weight of 522.48 g/mol. Its IUPAC name is 2-[3-(6-amino-3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-amine iodide.
| Compound Name | 2-[3-(6-amino-3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-amine iodide |
|---|---|
| PubChem CID | 75611665 |
| Molecular Formula | C21H23IN4S2 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | 2-[3-(6-amino-3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-amine iodide |
| SMILES | CCN1C(=CC=Cc2sc3cc(N)ccc3[n+]2CC)Sc2cc(N)ccc21.[I-] |
| InChI | InChI=1S/C21H23N4S2.HI/c1-3-24-16-10-8-14(22)12-18(16)26-20(24)6-5-7-21-25(4-2)17-11-9-15(23)13-19(17)27-21;/h5-13H,3-4,22-23H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | FTEXFAQGFPGJDA-UHFFFAOYSA-M |
| XLogP | 1.86 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|