C29H29N2O4S2+ — CID 91991594
3-[2-[3-[6-(2-carboxyprop-1-enyl)-3-ethyl-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]-2-methylprop-2-enoic acid (PubChem CID 91991594) has the molecular formula C29H29N2O4S2+ and a molecular weight of 533.70 g/mol. Its IUPAC name is 3-[2-[3-[6-(2-carboxyprop-1-enyl)-3-ethyl-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[2-[3-[6-(2-carboxyprop-1-enyl)-3-ethyl-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 91991594 |
| Molecular Formula | C29H29N2O4S2+ |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 3-[2-[3-[6-(2-carboxyprop-1-enyl)-3-ethyl-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]-2-methylprop-2-enoic acid |
| SMILES | CCN1C(=CC=Cc2sc3cc(C=C(C)C(=O)O)ccc3[n+]2CC)Sc2cc(C=C(C)C(=O)O)ccc21 |
| InChI | InChI=1S/C29H28N2O4S2/c1-5-30-22-12-10-20(14-18(3)28(32)33)16-24(22)36-26(30)8-7-9-27-31(6-2)23-13-11-21(17-25(23)37-27)15-19(4)29(34)35/h7-17H,5-6H2,1-4H3,(H-,32,33,34,35)/p+1 |
| InChIKey | GTKBBCAULXGVRW-UHFFFAOYSA-O |
| XLogP | 6.67 |
| TPSA | 81.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|