C28H25N4S2+ — CID 142158101
(E)-3-[(2Z)-2-[(E)-3-[6-[(E)-2-cyanoethenyl]-3-ethyl-1,3-benzothiazol-3-ium-2-yl]-2-methylprop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]prop-2-enenitrile (PubChem CID 142158101) has the molecular formula C28H25N4S2+ and a molecular weight of 481.67 g/mol. Its IUPAC name is (E)-3-[(2Z)-2-[(E)-3-[6-[(E)-2-cyanoethenyl]-3-ethyl-1,3-benzothiazol-3-ium-2-yl]-2-methylprop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[(2Z)-2-[(E)-3-[6-[(E)-2-cyanoethenyl]-3-ethyl-1,3-benzothiazol-3-ium-2-yl]-2-methylprop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 142158101 |
| Molecular Formula | C28H25N4S2+ |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | (E)-3-[(2Z)-2-[(E)-3-[6-[(E)-2-cyanoethenyl]-3-ethyl-1,3-benzothiazol-3-ium-2-yl]-2-methylprop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]prop-2-enenitrile |
| SMILES | CCN1/C(=C/C(C)=C/c2sc3cc(/C=C/C#N)ccc3[n+]2CC)Sc2cc(/C=C/C#N)ccc21 |
| InChI | InChI=1S/C28H25N4S2/c1-4-31-23-12-10-21(8-6-14-29)18-25(23)33-27(31)16-20(3)17-28-32(5-2)24-13-11-22(9-7-15-30)19-26(24)34-28/h6-13,16-19H,4-5H2,1-3H3/q+1/b8-6+,9-7+ |
| InChIKey | VHSBDLKLMKXUHF-CDJQDVQCSA-N |
| XLogP | 7.16 |
| TPSA | 54.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|