C30H29N2OS2+ — CID 177487184
(2Z)-3-ethyl-2-[(E,2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-(3-methoxyphenyl)but-3-enylidene]-1,3-benzothiazole (PubChem CID 177487184) has the molecular formula C30H29N2OS2+ and a molecular weight of 497.71 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(E,2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-(3-methoxyphenyl)but-3-enylidene]-1,3-benzothiazole.
| Compound Name | (2Z)-3-ethyl-2-[(E,2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-(3-methoxyphenyl)but-3-enylidene]-1,3-benzothiazole |
|---|---|
| PubChem CID | 177487184 |
| Molecular Formula | C30H29N2OS2+ |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | (2Z)-3-ethyl-2-[(E,2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-(3-methoxyphenyl)but-3-enylidene]-1,3-benzothiazole |
| SMILES | CCN1/C(=C/C(=C\c2sc3ccccc3[n+]2CC)/C=C/c2cccc(OC)c2)Sc2ccccc21 |
| InChI | InChI=1S/C30H29N2OS2/c1-4-31-25-13-6-8-15-27(25)34-29(31)20-23(18-17-22-11-10-12-24(19-22)33-3)21-30-32(5-2)26-14-7-9-16-28(26)35-30/h6-21H,4-5H2,1-3H3/q+1/b18-17+ |
| InChIKey | GXIRCQYZEWUJIK-ISLYRVAYSA-N |
| XLogP | 7.79 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|