C31H32N3S2+ — CID 177427107
4-[(1E,3Z)-4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-3-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]buta-1,3-dienyl]-N,N-dimethylaniline (PubChem CID 177427107) has the molecular formula C31H32N3S2+ and a molecular weight of 510.75 g/mol. Its IUPAC name is 4-[(1E,3Z)-4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-3-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]buta-1,3-dienyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1E,3Z)-4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-3-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]buta-1,3-dienyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 177427107 |
| Molecular Formula | C31H32N3S2+ |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 4-[(1E,3Z)-4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-3-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]buta-1,3-dienyl]-N,N-dimethylaniline |
| SMILES | CCN1/C(=C/C(=C\c2sc3ccccc3[n+]2CC)/C=C/c2ccc(N(C)C)cc2)Sc2ccccc21 |
| InChI | InChI=1S/C31H32N3S2/c1-5-33-26-11-7-9-13-28(26)35-30(33)21-24(16-15-23-17-19-25(20-18-23)32(3)4)22-31-34(6-2)27-12-8-10-14-29(27)36-31/h7-22H,5-6H2,1-4H3/q+1 |
| InChIKey | DDPJKSWNOHTTCY-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|