C33H35IN2S2 — CID 118731744
(2Z)-3-butyl-2-[(E,2E)-2-[(3-butyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-phenylbut-3-enylidene]-1,3-benzothiazole iodide (PubChem CID 118731744) has the molecular formula C33H35IN2S2 and a molecular weight of 650.70 g/mol. Its IUPAC name is (2Z)-3-butyl-2-[(E,2E)-2-[(3-butyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-phenylbut-3-enylidene]-1,3-benzothiazole iodide.
| Compound Name | (2Z)-3-butyl-2-[(E,2E)-2-[(3-butyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-phenylbut-3-enylidene]-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 118731744 |
| Molecular Formula | C33H35IN2S2 |
| Molecular Weight | 650.70 g/mol |
| Exact Mass | 650.13 |
| IUPAC Name | (2Z)-3-butyl-2-[(E,2E)-2-[(3-butyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-phenylbut-3-enylidene]-1,3-benzothiazole iodide |
| SMILES | CCCCN1/C(=C/C(/C=C/c2ccccc2)=C/c2sc3ccccc3[n+]2CCCC)Sc2ccccc21.[I-] |
| InChI | InChI=1S/C33H35N2S2.HI/c1-3-5-22-34-28-16-10-12-18-30(28)36-32(34)24-27(21-20-26-14-8-7-9-15-26)25-33-35(23-6-4-2)29-17-11-13-19-31(29)37-33;/h7-21,24-25H,3-6,22-23H2,1-2H3;1H/q+1;/p-1/b21-20+; |
| InChIKey | WJCQOXPDKOCYGV-ANVLNOONSA-M |
| XLogP | 6.34 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|