C29H26N3O2S2+ — CID 177458581
(2Z)-3-ethyl-2-[(E,2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-(4-nitrophenyl)but-3-enylidene]-1,3-benzothiazole (PubChem CID 177458581) has the molecular formula C29H26N3O2S2+ and a molecular weight of 512.68 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(E,2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-(4-nitrophenyl)but-3-enylidene]-1,3-benzothiazole.
| Compound Name | (2Z)-3-ethyl-2-[(E,2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-(4-nitrophenyl)but-3-enylidene]-1,3-benzothiazole |
|---|---|
| PubChem CID | 177458581 |
| Molecular Formula | C29H26N3O2S2+ |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | (2Z)-3-ethyl-2-[(E,2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-(4-nitrophenyl)but-3-enylidene]-1,3-benzothiazole |
| SMILES | CCN1/C(=C/C(=C\c2sc3ccccc3[n+]2CC)/C=C/c2ccc([N+](=O)[O-])cc2)Sc2ccccc21 |
| InChI | InChI=1S/C29H26N3O2S2/c1-3-30-24-9-5-7-11-26(24)35-28(30)19-22(14-13-21-15-17-23(18-16-21)32(33)34)20-29-31(4-2)25-10-6-8-12-27(25)36-29/h5-20H,3-4H2,1-2H3/q+1/b14-13+ |
| InChIKey | APSCRNOZQASGMT-BUHFOSPRSA-N |
| XLogP | 7.69 |
| TPSA | 50.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|