C23H23Cl2N3O3S2 — CID 126476173
(2Z)-5-chloro-2-[(2E)-2-[(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]butylidene]-3-ethyl-1,3-benzothiazole nitrate (PubChem CID 126476173) has the molecular formula C23H23Cl2N3O3S2 and a molecular weight of 524.50 g/mol. Its IUPAC name is (2Z)-5-chloro-2-[(2E)-2-[(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]butylidene]-3-ethyl-1,3-benzothiazole nitrate.
| Compound Name | (2Z)-5-chloro-2-[(2E)-2-[(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]butylidene]-3-ethyl-1,3-benzothiazole nitrate |
|---|---|
| PubChem CID | 126476173 |
| Molecular Formula | C23H23Cl2N3O3S2 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | (2Z)-5-chloro-2-[(2E)-2-[(5-chloro-3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]butylidene]-3-ethyl-1,3-benzothiazole nitrate |
| SMILES | CCC(/C=C1\Sc2ccc(Cl)cc2N1CC)=C\c1sc2ccc(Cl)cc2[n+]1CC.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C23H23Cl2N2S2.NO3/c1-4-15(11-22-26(5-2)18-13-16(24)7-9-20(18)28-22)12-23-27(6-3)19-14-17(25)8-10-21(19)29-23;2-1(3)4/h7-14H,4-6H2,1-3H3;/q+1;-1 |
| InChIKey | DQXBISCJWYDHGE-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 73.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|