C26H28Cl2N2O5S3 — CID 59952328
3-[5-chloro-2-[(E)-2-[(Z)-[5-chloro-3-(2-hydroxybutyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]-2-hydroxypropane-1-sulfonate (PubChem CID 59952328) has the molecular formula C26H28Cl2N2O5S3 and a molecular weight of 615.63 g/mol. Its IUPAC name is 3-[5-chloro-2-[(E)-2-[(Z)-[5-chloro-3-(2-hydroxybutyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]-2-hydroxypropane-1-sulfonate.
| Compound Name | 3-[5-chloro-2-[(E)-2-[(Z)-[5-chloro-3-(2-hydroxybutyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]-2-hydroxypropane-1-sulfonate |
|---|---|
| PubChem CID | 59952328 |
| Molecular Formula | C26H28Cl2N2O5S3 |
| Molecular Weight | 615.63 g/mol |
| Exact Mass | 614.05 |
| IUPAC Name | 3-[5-chloro-2-[(E)-2-[(Z)-[5-chloro-3-(2-hydroxybutyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]-2-hydroxypropane-1-sulfonate |
| SMILES | CCC(/C=C1\Sc2ccc(Cl)cc2N1CC(O)CC)=C\c1sc2ccc(Cl)cc2[n+]1CC(O)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C26H28Cl2N2O5S3/c1-3-16(9-25-29(13-19(31)4-2)21-11-17(27)5-7-23(21)36-25)10-26-30(14-20(32)15-38(33,34)35)22-12-18(28)6-8-24(22)37-26/h5-12,19-20,31-32H,3-4,13-15H2,1-2H3 |
| InChIKey | HBVYTYMLDXAXLR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|