C25H26Cl2N2O5S4 — CID 54299013
3-[5-chloro-2-[2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfinate (PubChem CID 54299013) has the molecular formula C25H26Cl2N2O5S4 and a molecular weight of 633.67 g/mol. Its IUPAC name is 3-[5-chloro-2-[2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfinate.
| Compound Name | 3-[5-chloro-2-[2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfinate |
|---|---|
| PubChem CID | 54299013 |
| Molecular Formula | C25H26Cl2N2O5S4 |
| Molecular Weight | 633.67 g/mol |
| Exact Mass | 632.01 |
| IUPAC Name | 3-[5-chloro-2-[2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfinate |
| SMILES | CCC(=Cc1sc2ccc(Cl)cc2[n+]1CCCS(=O)(=O)O)C=C1Sc2ccc(Cl)cc2N1CCCS(=O)[O-] |
| InChI | InChI=1S/C25H26Cl2N2O5S4/c1-2-17(13-24-28(9-3-11-37(30)31)20-15-18(26)5-7-22(20)35-24)14-25-29(10-4-12-38(32,33)34)21-16-19(27)6-8-23(21)36-25/h5-8,13-16H,2-4,9-12H2,1H3,(H-,30,31,32,33,34) |
| InChIKey | AWNIYLLUGYZAIN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.67 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|