C25H27Cl2N2O5S3+ — CID 91077913
3-[5-chloro-2-[2-[[5-chloro-3-[3-(trioxidanyl)propyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfinic acid (PubChem CID 91077913) has the molecular formula C25H27Cl2N2O5S3+ and a molecular weight of 602.61 g/mol. Its IUPAC name is 3-[5-chloro-2-[2-[[5-chloro-3-[3-(trioxidanyl)propyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfinic acid.
| Compound Name | 3-[5-chloro-2-[2-[[5-chloro-3-[3-(trioxidanyl)propyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfinic acid |
|---|---|
| PubChem CID | 91077913 |
| Molecular Formula | C25H27Cl2N2O5S3+ |
| Molecular Weight | 602.61 g/mol |
| Exact Mass | 601.05 |
| IUPAC Name | 3-[5-chloro-2-[2-[[5-chloro-3-[3-(trioxidanyl)propyl]-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfinic acid |
| SMILES | CCC(=Cc1sc2ccc(Cl)cc2[n+]1CCCOOO)C=C1Sc2ccc(Cl)cc2N1CCCS(=O)O |
| InChI | InChI=1S/C25H26Cl2N2O5S3/c1-2-17(13-24-28(9-3-11-33-34-30)20-15-18(26)5-7-22(20)35-24)14-25-29(10-4-12-37(31)32)21-16-19(27)6-8-23(21)36-25/h5-8,13-16H,2-4,9-12H2,1H3,(H-,30,31,32)/p+1 |
| InChIKey | GFSZPJIJJROEGM-UHFFFAOYSA-O |
| XLogP | 7.17 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.61 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|