C30H31Cl2N3O6S4+2 — CID 177462970
3-[5-chloro-2-[(E)-2-[(E)-[5-chloro-3-(3-pyridin-1-ium-1-yloxysulfonylpropyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid (PubChem CID 177462970) has the molecular formula C30H31Cl2N3O6S4+2 and a molecular weight of 728.77 g/mol. Its IUPAC name is 3-[5-chloro-2-[(E)-2-[(E)-[5-chloro-3-(3-pyridin-1-ium-1-yloxysulfonylpropyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5-chloro-2-[(E)-2-[(E)-[5-chloro-3-(3-pyridin-1-ium-1-yloxysulfonylpropyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 177462970 |
| Molecular Formula | C30H31Cl2N3O6S4+2 |
| Molecular Weight | 728.77 g/mol |
| Exact Mass | 727.05 |
| IUPAC Name | 3-[5-chloro-2-[(E)-2-[(E)-[5-chloro-3-(3-pyridin-1-ium-1-yloxysulfonylpropyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid |
| SMILES | CCC(=C\c1sc2ccc(Cl)cc2[n+]1CCCS(=O)(=O)O)/C=C1/Sc2ccc(Cl)cc2N1CCCS(=O)(=O)O[n+]1ccccc1 |
| InChI | InChI=1S/C30H30Cl2N3O6S4/c1-2-22(18-29-34(14-6-16-44(36,37)38)25-20-23(31)8-10-27(25)42-29)19-30-35(26-21-24(32)9-11-28(26)43-30)15-7-17-45(39,40)41-33-12-4-3-5-13-33/h3-5,8-13,18-21H,2,6-7,14-17H2,1H3/q+1/p+1 |
| InChIKey | LNVIOTPAPVSSHM-UHFFFAOYSA-O |
| XLogP | 6.16 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.77 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|