C25H29IN2O2S2 — CID 91870624
3-ethyl-2-[2-[(3-ethyl-5-methoxy-1,3-benzothiazol-3-ium-2-yl)methylidene]butylidene]-5-methoxy-1,3-benzothiazole iodide (PubChem CID 91870624) has the molecular formula C25H29IN2O2S2 and a molecular weight of 580.56 g/mol. Its IUPAC name is 3-ethyl-2-[2-[(3-ethyl-5-methoxy-1,3-benzothiazol-3-ium-2-yl)methylidene]butylidene]-5-methoxy-1,3-benzothiazole iodide.
| Compound Name | 3-ethyl-2-[2-[(3-ethyl-5-methoxy-1,3-benzothiazol-3-ium-2-yl)methylidene]butylidene]-5-methoxy-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 91870624 |
| Molecular Formula | C25H29IN2O2S2 |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 580.07 |
| IUPAC Name | 3-ethyl-2-[2-[(3-ethyl-5-methoxy-1,3-benzothiazol-3-ium-2-yl)methylidene]butylidene]-5-methoxy-1,3-benzothiazole iodide |
| SMILES | CCC(=Cc1sc2ccc(OC)cc2[n+]1CC)C=C1Sc2ccc(OC)cc2N1CC.[I-] |
| InChI | InChI=1S/C25H29N2O2S2.HI/c1-6-17(13-24-26(7-2)20-15-18(28-4)9-11-22(20)30-24)14-25-27(8-3)21-16-19(29-5)10-12-23(21)31-25;/h9-16H,6-8H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | RWVAKBBHEDIQGY-UHFFFAOYSA-M |
| XLogP | 3.50 |
| TPSA | 25.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|