C27H29N2O2S3+ — CID 4252022
1-ethyl-2-[2-[(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium (PubChem CID 4252022) has the molecular formula C27H29N2O2S3+ and a molecular weight of 509.74 g/mol. Its IUPAC name is 1-ethyl-2-[2-[(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium.
| Compound Name | 1-ethyl-2-[2-[(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium |
|---|---|
| PubChem CID | 4252022 |
| Molecular Formula | C27H29N2O2S3+ |
| Molecular Weight | 509.74 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 1-ethyl-2-[2-[(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium |
| SMILES | CCC(=Cc1sc2cc(OC)c3ccsc3c2[n+]1CC)C=C1Sc2ccc(OC)cc2N1CC |
| InChI | InChI=1S/C27H29N2O2S3/c1-6-17(13-24-28(7-2)20-15-18(30-4)9-10-22(20)33-24)14-25-29(8-3)26-23(34-25)16-21(31-5)19-11-12-32-27(19)26/h9-16H,6-8H2,1-5H3/q+1 |
| InChIKey | UOXCKPURIAROAE-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 25.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.74 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|