C29H32N2O7S5 — CID 4291064
3-[5-methoxy-2-[2-[[5-methyl-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]thieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 4291064) has the molecular formula C29H32N2O7S5 and a molecular weight of 680.92 g/mol. Its IUPAC name is 3-[5-methoxy-2-[2-[[5-methyl-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]thieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[5-methoxy-2-[2-[[5-methyl-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]thieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 4291064 |
| Molecular Formula | C29H32N2O7S5 |
| Molecular Weight | 680.92 g/mol |
| Exact Mass | 680.08 |
| IUPAC Name | 3-[5-methoxy-2-[2-[[5-methyl-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]thieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CCC(=Cc1sc2cc(OC)c3ccsc3c2[n+]1CCCS(=O)(=O)[O-])C=C1Sc2ccc(C)cc2N1CCCS(=O)(=O)O |
| InChI | InChI=1S/C29H32N2O7S5/c1-4-20(16-26-30(10-5-13-42(32,33)34)22-15-19(2)7-8-24(22)40-26)17-27-31(11-6-14-43(35,36)37)28-25(41-27)18-23(38-3)21-9-12-39-29(21)28/h7-9,12,15-18H,4-6,10-11,13-14H2,1-3H3,(H-,32,33,34,35,36,37) |
| InChIKey | XGADRHYGJJYSPG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.92 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|