C32H33N2O7S5+ — CID 15404339
3-[(2Z)-5-methoxy-2-[(2E)-2-[[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]butylidene]thieno[2,3-e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid (PubChem CID 15404339) has the molecular formula C32H33N2O7S5+ and a molecular weight of 717.96 g/mol. Its IUPAC name is 3-[(2Z)-5-methoxy-2-[(2E)-2-[[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]butylidene]thieno[2,3-e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2Z)-5-methoxy-2-[(2E)-2-[[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]butylidene]thieno[2,3-e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 15404339 |
| Molecular Formula | C32H33N2O7S5+ |
| Molecular Weight | 717.96 g/mol |
| Exact Mass | 717.09 |
| IUPAC Name | 3-[(2Z)-5-methoxy-2-[(2E)-2-[[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]butylidene]thieno[2,3-e][1,3]benzothiazol-1-yl]propane-1-sulfonic acid |
| SMILES | CCC(/C=C1\Sc2cc(OC)c3ccsc3c2N1CCCS(=O)(=O)O)=C\c1sc2ccc3ccccc3c2[n+]1CCCS(=O)(=O)O |
| InChI | InChI=1S/C32H32N2O7S5/c1-3-21(18-28-33(13-6-16-45(35,36)37)30-23-9-5-4-8-22(23)10-11-26(30)43-28)19-29-34(14-7-17-46(38,39)40)31-27(44-29)20-25(41-2)24-12-15-42-32(24)31/h4-5,8-12,15,18-20H,3,6-7,13-14,16-17H2,1-2H3,(H-,35,36,37,38,39,40)/p+1 |
| InChIKey | HDUGYXYQNWLDBG-UHFFFAOYSA-O |
| XLogP | 7.37 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.96 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|