C31H30N2O4S4 — CID 4657394
3-[2-[2-[(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)methyl]but-1-enyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 4657394) has the molecular formula C31H30N2O4S4 and a molecular weight of 622.86 g/mol. Its IUPAC name is 3-[2-[2-[(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)methyl]but-1-enyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[2-[(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)methyl]but-1-enyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 4657394 |
| Molecular Formula | C31H30N2O4S4 |
| Molecular Weight | 622.86 g/mol |
| Exact Mass | 622.11 |
| IUPAC Name | 3-[2-[2-[(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)methyl]but-1-enyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CCC(=Cc1sc2cc(OC)c3ccsc3c2[n+]1CCCS(=O)(=O)[O-])C=C1Sc2ccc3ccccc3c2N1CC |
| InChI | InChI=1S/C31H30N2O4S4/c1-4-20(17-27-32(5-2)29-22-10-7-6-9-21(22)11-12-25(29)39-27)18-28-33(14-8-16-41(34,35)36)30-26(40-28)19-24(37-3)23-13-15-38-31(23)30/h6-7,9-13,15,17-19H,4-5,8,14,16H2,1-3H3 |
| InChIKey | OKMIOMONTFCWMN-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.86 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|