C28H30N2O6S4 — CID 3378441
3-[2-[2-[[3-(2-hydroxyethyl)-5-methoxy-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 3378441) has the molecular formula C28H30N2O6S4 and a molecular weight of 618.82 g/mol. Its IUPAC name is 3-[2-[2-[[3-(2-hydroxyethyl)-5-methoxy-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[2-[[3-(2-hydroxyethyl)-5-methoxy-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 3378441 |
| Molecular Formula | C28H30N2O6S4 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.10 |
| IUPAC Name | 3-[2-[2-[[3-(2-hydroxyethyl)-5-methoxy-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]-5-methoxythieno[2,3-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CCC(=Cc1sc2cc(OC)c3ccsc3c2[n+]1CCCS(=O)(=O)[O-])C=C1Sc2ccc(OC)cc2N1CCO |
| InChI | InChI=1S/C28H30N2O6S4/c1-4-18(14-25-29(10-11-31)21-16-19(35-2)6-7-23(21)38-25)15-26-30(9-5-13-40(32,33)34)27-24(39-26)17-22(36-3)20-8-12-37-28(20)27/h6-8,12,14-17,31H,4-5,9-11,13H2,1-3H3 |
| InChIKey | RCSARCBNXVHQQB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|