C29H31N2O4S3+ — CID 2793281
3-[2-[2-[(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 2793281) has the molecular formula C29H31N2O4S3+ and a molecular weight of 567.78 g/mol. Its IUPAC name is 3-[2-[2-[(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[2-[(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 2793281 |
| Molecular Formula | C29H31N2O4S3+ |
| Molecular Weight | 567.78 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | 3-[2-[2-[(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CCC(=Cc1sc2ccc3ccccc3c2[n+]1CCCS(=O)(=O)O)C=C1Sc2ccc(OC)cc2N1CC |
| InChI | InChI=1S/C29H30N2O4S3/c1-4-20(17-27-30(5-2)24-19-22(35-3)12-14-25(24)36-27)18-28-31(15-8-16-38(32,33)34)29-23-10-7-6-9-21(23)11-13-26(29)37-28/h6-7,9-14,17-19H,4-5,8,15-16H2,1-3H3/p+1 |
| InChIKey | KXCGSQMCYUGTHP-UHFFFAOYSA-O |
| XLogP | 6.90 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.78 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|