C36H34N2O3S3 — CID 4829236
3-[2-[2-[[3-ethyl-6-(2-phenylethenyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 4829236) has the molecular formula C36H34N2O3S3 and a molecular weight of 638.88 g/mol. Its IUPAC name is 3-[2-[2-[[3-ethyl-6-(2-phenylethenyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[2-[[3-ethyl-6-(2-phenylethenyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 4829236 |
| Molecular Formula | C36H34N2O3S3 |
| Molecular Weight | 638.88 g/mol |
| Exact Mass | 638.17 |
| IUPAC Name | 3-[2-[2-[[3-ethyl-6-(2-phenylethenyl)-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CCC(=Cc1sc2ccc3ccccc3c2[n+]1CCCS(=O)(=O)[O-])C=C1Sc2cc(C=Cc3ccccc3)ccc2N1CC |
| InChI | InChI=1S/C36H34N2O3S3/c1-3-26(24-34-37(4-2)31-19-17-28(23-33(31)43-34)16-15-27-11-6-5-7-12-27)25-35-38(21-10-22-44(39,40)41)36-30-14-9-8-13-29(30)18-20-32(36)42-35/h5-9,11-20,23-25H,3-4,10,21-22H2,1-2H3 |
| InChIKey | PDHAQOSAGWRIKS-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.88 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|